C32H33N3O4S — CID 43901818
N-[3-[[2-[N-(benzenesulfonyl)-4-methylanilino]acetyl]amino]phenyl]-4-tert-butylbenzamide (PubChem CID 43901818) has the molecular formula C32H33N3O4S and a molecular weight of 555.70 g/mol. Its IUPAC name is N-[3-[[2-[N-(benzenesulfonyl)-4-methylanilino]acetyl]amino]phenyl]-4-tert-butylbenzamide.
| Compound Name | N-[3-[[2-[N-(benzenesulfonyl)-4-methylanilino]acetyl]amino]phenyl]-4-tert-butylbenzamide |
|---|---|
| PubChem CID | 43901818 |
| Molecular Formula | C32H33N3O4S |
| Molecular Weight | 555.70 g/mol |
| Exact Mass | 555.22 |
| IUPAC Name | N-[3-[[2-[N-(benzenesulfonyl)-4-methylanilino]acetyl]amino]phenyl]-4-tert-butylbenzamide |
| SMILES | Cc1ccc(N(CC(=O)Nc2cccc(NC(=O)c3ccc(C(C)(C)C)cc3)c2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H33N3O4S/c1-23-13-19-28(20-14-23)35(40(38,39)29-11-6-5-7-12-29)22-30(36)33-26-9-8-10-27(21-26)34-31(37)24-15-17-25(18-16-24)32(2,3)4/h5-21H,22H2,1-4H3,(H,33,36)(H,34,37) |
| InChIKey | TWZSCJQBOSMMCU-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.70 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |