C21H17N5O2 — CID 43903618
3-anilino-6-(furan-2-yl)-1-pyrimidin-2-yl-6,7-dihydro-5H-indazol-4-one (PubChem CID 43903618) has the molecular formula C21H17N5O2 and a molecular weight of 371.40 g/mol. Its IUPAC name is 3-anilino-6-(furan-2-yl)-1-pyrimidin-2-yl-6,7-dihydro-5H-indazol-4-one.
| Compound Name | 3-anilino-6-(furan-2-yl)-1-pyrimidin-2-yl-6,7-dihydro-5H-indazol-4-one |
|---|---|
| PubChem CID | 43903618 |
| Molecular Formula | C21H17N5O2 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 3-anilino-6-(furan-2-yl)-1-pyrimidin-2-yl-6,7-dihydro-5H-indazol-4-one |
| SMILES | O=C1CC(c2ccco2)Cc2c1c(Nc1ccccc1)nn2-c1ncccn1 |
| InChI | InChI=1S/C21H17N5O2/c27-17-13-14(18-8-4-11-28-18)12-16-19(17)20(24-15-6-2-1-3-7-15)25-26(16)21-22-9-5-10-23-21/h1-11,14H,12-13H2,(H,24,25) |
| InChIKey | ZWTHFXNDPPPJPA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |