C19H19Br2ClN2O3S — CID 43905199
N-(4-bromo-3-chlorophenyl)-1-[(4-bromophenyl)methylsulfonyl]piperidine-4-carboxamide (PubChem CID 43905199) has the molecular formula C19H19Br2ClN2O3S and a molecular weight of 550.70 g/mol. Its IUPAC name is N-(4-bromo-3-chlorophenyl)-1-[(4-bromophenyl)methylsulfonyl]piperidine-4-carboxamide.
| Compound Name | N-(4-bromo-3-chlorophenyl)-1-[(4-bromophenyl)methylsulfonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 43905199 |
| Molecular Formula | C19H19Br2ClN2O3S |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 547.92 |
| IUPAC Name | N-(4-bromo-3-chlorophenyl)-1-[(4-bromophenyl)methylsulfonyl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(Br)c(Cl)c1)C1CCN(S(=O)(=O)Cc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C19H19Br2ClN2O3S/c20-15-3-1-13(2-4-15)12-28(26,27)24-9-7-14(8-10-24)19(25)23-16-5-6-17(21)18(22)11-16/h1-6,11,14H,7-10,12H2,(H,23,25) |
| InChIKey | UHXZMYBOANFNAZ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |