C25H24Cl2N2O6S — CID 43905900
ethyl 2-chloro-5-[[2-(N-(4-chlorophenyl)sulfonyl-4-ethoxyanilino)acetyl]amino]benzoate (PubChem CID 43905900) has the molecular formula C25H24Cl2N2O6S and a molecular weight of 551.45 g/mol. Its IUPAC name is ethyl 2-chloro-5-[[2-(N-(4-chlorophenyl)sulfonyl-4-ethoxyanilino)acetyl]amino]benzoate.
| Compound Name | ethyl 2-chloro-5-[[2-(N-(4-chlorophenyl)sulfonyl-4-ethoxyanilino)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 43905900 |
| Molecular Formula | C25H24Cl2N2O6S |
| Molecular Weight | 551.45 g/mol |
| Exact Mass | 550.07 |
| IUPAC Name | ethyl 2-chloro-5-[[2-(N-(4-chlorophenyl)sulfonyl-4-ethoxyanilino)acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1cc(NC(=O)CN(c2ccc(OCC)cc2)S(=O)(=O)c2ccc(Cl)cc2)ccc1Cl |
| InChI | InChI=1S/C25H24Cl2N2O6S/c1-3-34-20-10-8-19(9-11-20)29(36(32,33)21-12-5-17(26)6-13-21)16-24(30)28-18-7-14-23(27)22(15-18)25(31)35-4-2/h5-15H,3-4,16H2,1-2H3,(H,28,30) |
| InChIKey | FPDBGZAJOPCQSA-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.45 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |