About 2-methyl-N-pentan-2-yl-1,3-oxazole-4-carboxamide
2-methyl-N-pentan-2-yl-1,3-oxazole-4-carboxamide (PubChem CID 43906526) has the molecular formula C10H16N2O2
and a molecular weight of 196.25 g/mol. Its IUPAC name is 2-methyl-N-pentan-2-yl-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-methyl-N-pentan-2-yl-1,3-oxazole-4-carboxamide |
| PubChem CID | 43906526 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 2-methyl-N-pentan-2-yl-1,3-oxazole-4-carboxamide |
| SMILES | CCCC(C)NC(=O)c1coc(C)n1 |
| InChI | InChI=1S/C10H16N2O2/c1-4-5-7(2)11-10(13)9-6-14-8(3)12-9/h6-7H,4-5H2,1-3H3,(H,11,13) |
| InChIKey | TXEIMMQKROBUQL-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-N-pentan-2-yl-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-pentan-2-yl-1,3-oxazole-4-carboxamide?
The IUPAC name of 2-methyl-N-pentan-2-yl-1,3-oxazole-4-carboxamide (CID 43906526) is 2-methyl-N-pentan-2-yl-1,3-oxazole-4-carboxamide.
What is the SMILES notation for 2-methyl-N-pentan-2-yl-1,3-oxazole-4-carboxamide?
The canonical SMILES for 2-methyl-N-pentan-2-yl-1,3-oxazole-4-carboxamide is CCCC(C)NC(=O)c1coc(C)n1.
What is the InChIKey of 2-methyl-N-pentan-2-yl-1,3-oxazole-4-carboxamide?
The InChIKey is TXEIMMQKROBUQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2/c1-4-5-7(2)11-10(13)9-6-14-8(3)12-9/h6-7H,4-5H2,1-3H3,(H,11,13).
What are the key properties of 2-methyl-N-pentan-2-yl-1,3-oxazole-4-carboxamide?
2-methyl-N-pentan-2-yl-1,3-oxazole-4-carboxamide has a molecular weight of 196.25 g/mol, XLogP of 1.90, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-pentan-2-yl-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 43906526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).