C25H23ClN2O6 — CID 43907023
[4-[(E)-[[2-(4-chloro-3-methylphenoxy)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-methoxybenzoate (PubChem CID 43907023) has the molecular formula C25H23ClN2O6 and a molecular weight of 482.92 g/mol. Its IUPAC name is [4-[(E)-[[2-(4-chloro-3-methylphenoxy)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-methoxybenzoate.
| Compound Name | [4-[(E)-[[2-(4-chloro-3-methylphenoxy)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 43907023 |
| Molecular Formula | C25H23ClN2O6 |
| Molecular Weight | 482.92 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | [4-[(E)-[[2-(4-chloro-3-methylphenoxy)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)Oc2ccc(/C=N/NC(=O)COc3ccc(Cl)c(C)c3)cc2OC)c1 |
| InChI | InChI=1S/C25H23ClN2O6/c1-16-11-20(8-9-21(16)26)33-15-24(29)28-27-14-17-7-10-22(23(12-17)32-3)34-25(30)18-5-4-6-19(13-18)31-2/h4-14H,15H2,1-3H3,(H,28,29)/b27-14+ |
| InChIKey | IPQBKFJAEATUTR-MZJWZYIUSA-N |
| XLogP | 4.41 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.92 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|