C21H22N4O3 — CID 43907955
3-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-[(4-imidazol-1-ylphenyl)methyl]propanamide (PubChem CID 43907955) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is 3-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-[(4-imidazol-1-ylphenyl)methyl]propanamide.
| Compound Name | 3-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-[(4-imidazol-1-ylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 43907955 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 3-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-[(4-imidazol-1-ylphenyl)methyl]propanamide |
| SMILES | O=C(CCN1C(=O)C2CC=CCC2C1=O)NCc1ccc(-n2ccnc2)cc1 |
| InChI | InChI=1S/C21H22N4O3/c26-19(9-11-25-20(27)17-3-1-2-4-18(17)21(25)28)23-13-15-5-7-16(8-6-15)24-12-10-22-14-24/h1-2,5-8,10,12,14,17-18H,3-4,9,11,13H2,(H,23,26) |
| InChIKey | RCVYINALNDQECD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|