About 3-amino-N,N-bis(2-hydroxyethyl)benzenesulfonamide
3-amino-N,N-bis(2-hydroxyethyl)benzenesulfonamide (PubChem CID 4391) has the molecular formula C10H16N2O4S
and a molecular weight of 260.31 g/mol. Its IUPAC name is 3-amino-N,N-bis(2-hydroxyethyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 3-amino-N,N-bis(2-hydroxyethyl)benzenesulfonamide |
| PubChem CID | 4391 |
| Molecular Formula | C10H16N2O4S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 3-amino-N,N-bis(2-hydroxyethyl)benzenesulfonamide |
| SMILES | Nc1cccc(S(=O)(=O)N(CCO)CCO)c1 |
| InChI | InChI=1S/C10H16N2O4S/c11-9-2-1-3-10(8-9)17(15,16)12(4-6-13)5-7-14/h1-3,8,13-14H,4-7,11H2 |
| InChIKey | LHDUDYKYYNDASR-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-N,N-bis(2-hydroxyethyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N,N-bis(2-hydroxyethyl)benzenesulfonamide?
The IUPAC name of 3-amino-N,N-bis(2-hydroxyethyl)benzenesulfonamide (CID 4391) is 3-amino-N,N-bis(2-hydroxyethyl)benzenesulfonamide.
What is the SMILES notation for 3-amino-N,N-bis(2-hydroxyethyl)benzenesulfonamide?
The canonical SMILES for 3-amino-N,N-bis(2-hydroxyethyl)benzenesulfonamide is Nc1cccc(S(=O)(=O)N(CCO)CCO)c1.
What is the InChIKey of 3-amino-N,N-bis(2-hydroxyethyl)benzenesulfonamide?
The InChIKey is LHDUDYKYYNDASR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O4S/c11-9-2-1-3-10(8-9)17(15,16)12(4-6-13)5-7-14/h1-3,8,13-14H,4-7,11H2.
What are the key properties of 3-amino-N,N-bis(2-hydroxyethyl)benzenesulfonamide?
3-amino-N,N-bis(2-hydroxyethyl)benzenesulfonamide has a molecular weight of 260.31 g/mol, XLogP of -0.76, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N,N-bis(2-hydroxyethyl)benzenesulfonamide is sourced from PubChem (CID 4391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).