C14H14N2O3 — CID 43911392
3-methyl-N-(2-prop-2-enoxyphenyl)-1,2-oxazole-5-carboxamide (PubChem CID 43911392) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is 3-methyl-N-(2-prop-2-enoxyphenyl)-1,2-oxazole-5-carboxamide.
| Compound Name | 3-methyl-N-(2-prop-2-enoxyphenyl)-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 43911392 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 3-methyl-N-(2-prop-2-enoxyphenyl)-1,2-oxazole-5-carboxamide |
| SMILES | C=CCOc1ccccc1NC(=O)c1cc(C)no1 |
| InChI | InChI=1S/C14H14N2O3/c1-3-8-18-12-7-5-4-6-11(12)15-14(17)13-9-10(2)16-19-13/h3-7,9H,1,8H2,2H3,(H,15,17) |
| InChIKey | GYEUROIOUVBHEW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|