C17H22N2O4 — CID 43912125
ethyl (E)-4-[3-[3-(dimethylamino)-3-oxopropyl]anilino]-4-oxobut-2-enoate (PubChem CID 43912125) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is ethyl (E)-4-[3-[3-(dimethylamino)-3-oxopropyl]anilino]-4-oxobut-2-enoate.
| Compound Name | ethyl (E)-4-[3-[3-(dimethylamino)-3-oxopropyl]anilino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 43912125 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | ethyl (E)-4-[3-[3-(dimethylamino)-3-oxopropyl]anilino]-4-oxobut-2-enoate |
| SMILES | CCOC(=O)/C=C/C(=O)Nc1cccc(CCC(=O)N(C)C)c1 |
| InChI | InChI=1S/C17H22N2O4/c1-4-23-17(22)11-9-15(20)18-14-7-5-6-13(12-14)8-10-16(21)19(2)3/h5-7,9,11-12H,4,8,10H2,1-3H3,(H,18,20)/b11-9+ |
| InChIKey | FANCDKXQZDEKLA-PKNBQFBNSA-N |
| XLogP | 1.77 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|