C18H19NO4 — CID 43912315
3-[(2,4,5-trimethoxyphenyl)methyl]-1,3-dihydroindol-2-one (PubChem CID 43912315) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is 3-[(2,4,5-trimethoxyphenyl)methyl]-1,3-dihydroindol-2-one.
| Compound Name | 3-[(2,4,5-trimethoxyphenyl)methyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 43912315 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 3-[(2,4,5-trimethoxyphenyl)methyl]-1,3-dihydroindol-2-one |
| SMILES | COc1cc(OC)c(OC)cc1CC1C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C18H19NO4/c1-21-15-10-17(23-3)16(22-2)9-11(15)8-13-12-6-4-5-7-14(12)19-18(13)20/h4-7,9-10,13H,8H2,1-3H3,(H,19,20) |
| InChIKey | YEIMZWPASKCWHW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |