C19H21NO4 — CID 43912363
7-methyl-3-[(2,4,5-trimethoxyphenyl)methyl]-1,3-dihydroindol-2-one (PubChem CID 43912363) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is 7-methyl-3-[(2,4,5-trimethoxyphenyl)methyl]-1,3-dihydroindol-2-one.
| Compound Name | 7-methyl-3-[(2,4,5-trimethoxyphenyl)methyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 43912363 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 7-methyl-3-[(2,4,5-trimethoxyphenyl)methyl]-1,3-dihydroindol-2-one |
| SMILES | COc1cc(OC)c(OC)cc1CC1C(=O)Nc2c(C)cccc21 |
| InChI | InChI=1S/C19H21NO4/c1-11-6-5-7-13-14(19(21)20-18(11)13)8-12-9-16(23-3)17(24-4)10-15(12)22-2/h5-7,9-10,14H,8H2,1-4H3,(H,20,21) |
| InChIKey | JSDVGKNNRBTWPU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |