About 3-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-methyl-3H-indol-2-one
3-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-methyl-3H-indol-2-one (PubChem CID 43912424) has the molecular formula C18H18BrNO3
and a molecular weight of 376.25 g/mol. Its IUPAC name is 3-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-methyl-3H-indol-2-one.
Molecular Properties
| Compound Name | 3-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-methyl-3H-indol-2-one |
| PubChem CID | 43912424 |
| Molecular Formula | C18H18BrNO3 |
| Molecular Weight | 376.25 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | 3-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-methyl-3H-indol-2-one |
| SMILES | COc1cc(Br)c(CC2C(=O)N(C)c3ccccc32)cc1OC |
| InChI | InChI=1S/C18H18BrNO3/c1-20-15-7-5-4-6-12(15)13(18(20)21)8-11-9-16(22-2)17(23-3)10-14(11)19/h4-7,9-10,13H,8H2,1-3H3 |
| InChIKey | JSJNHRNYRDXMCM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.25 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-methyl-3H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-methyl-3H-indol-2-one?
The IUPAC name of 3-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-methyl-3H-indol-2-one (CID 43912424) is 3-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-methyl-3H-indol-2-one.
What is the SMILES notation for 3-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-methyl-3H-indol-2-one?
The canonical SMILES for 3-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-methyl-3H-indol-2-one is COc1cc(Br)c(CC2C(=O)N(C)c3ccccc32)cc1OC.
What is the InChIKey of 3-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-methyl-3H-indol-2-one?
The InChIKey is JSJNHRNYRDXMCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18BrNO3/c1-20-15-7-5-4-6-12(15)13(18(20)21)8-11-9-16(22-2)17(23-3)10-14(11)19/h4-7,9-10,13H,8H2,1-3H3.
What are the key properties of 3-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-methyl-3H-indol-2-one?
3-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-methyl-3H-indol-2-one has a molecular weight of 376.25 g/mol, XLogP of 3.77, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-methyl-3H-indol-2-one is sourced from PubChem (CID 43912424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).