C21H24O3 — CID 43912854
(5R)-3'-methylspiro[4,17-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),2,8,11(15)-tetraene-5,1'-cyclohexane]-16-one (PubChem CID 43912854) has the molecular formula C21H24O3 and a molecular weight of 324.42 g/mol. Its IUPAC name is (5R)-3'-methylspiro[4,17-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),2,8,11(15)-tetraene-5,1'-cyclohexane]-16-one.
| Compound Name | (5R)-3'-methylspiro[4,17-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),2,8,11(15)-tetraene-5,1'-cyclohexane]-16-one |
|---|---|
| PubChem CID | 43912854 |
| Molecular Formula | C21H24O3 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | (5R)-3'-methylspiro[4,17-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),2,8,11(15)-tetraene-5,1'-cyclohexane]-16-one |
| SMILES | CC1CCC[C@@]2(CCc3cc4c5c(c(=O)oc4cc3O2)CCC5)C1 |
| InChI | InChI=1S/C21H24O3/c1-13-4-3-8-21(12-13)9-7-14-10-17-15-5-2-6-16(15)20(22)23-19(17)11-18(14)24-21/h10-11,13H,2-9,12H2,1H3/t13?,21-/m1/s1 |
| InChIKey | ODZKOGJLVWIJHF-QUXALOBESA-N |
| XLogP | 4.56 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|