C24H13Cl2IN2O3 — CID 43914043
N-[2-(2-chloro-5-iodophenyl)-1,3-benzoxazol-5-yl]-5-(3-chlorophenyl)furan-2-carboxamide (PubChem CID 43914043) has the molecular formula C24H13Cl2IN2O3 and a molecular weight of 575.19 g/mol. Its IUPAC name is N-[2-(2-chloro-5-iodophenyl)-1,3-benzoxazol-5-yl]-5-(3-chlorophenyl)furan-2-carboxamide.
| Compound Name | N-[2-(2-chloro-5-iodophenyl)-1,3-benzoxazol-5-yl]-5-(3-chlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 43914043 |
| Molecular Formula | C24H13Cl2IN2O3 |
| Molecular Weight | 575.19 g/mol |
| Exact Mass | 573.93 |
| IUPAC Name | N-[2-(2-chloro-5-iodophenyl)-1,3-benzoxazol-5-yl]-5-(3-chlorophenyl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccc2oc(-c3cc(I)ccc3Cl)nc2c1)c1ccc(-c2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C24H13Cl2IN2O3/c25-14-3-1-2-13(10-14)20-8-9-22(31-20)23(30)28-16-5-7-21-19(12-16)29-24(32-21)17-11-15(27)4-6-18(17)26/h1-12H,(H,28,30) |
| InChIKey | HRZZESNTEZDEBP-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.19 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|