C19H29N3O2S — CID 43915035
N-[[4-[2-(dimethylamino)-2-oxoethyl]phenyl]carbamothioyl]octanamide (PubChem CID 43915035) has the molecular formula C19H29N3O2S and a molecular weight of 363.53 g/mol. Its IUPAC name is N-[[4-[2-(dimethylamino)-2-oxoethyl]phenyl]carbamothioyl]octanamide.
| Compound Name | N-[[4-[2-(dimethylamino)-2-oxoethyl]phenyl]carbamothioyl]octanamide |
|---|---|
| PubChem CID | 43915035 |
| Molecular Formula | C19H29N3O2S |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | N-[[4-[2-(dimethylamino)-2-oxoethyl]phenyl]carbamothioyl]octanamide |
| SMILES | CCCCCCCC(=O)NC(=S)Nc1ccc(CC(=O)N(C)C)cc1 |
| InChI | InChI=1S/C19H29N3O2S/c1-4-5-6-7-8-9-17(23)21-19(25)20-16-12-10-15(11-13-16)14-18(24)22(2)3/h10-13H,4-9,14H2,1-3H3,(H2,20,21,23,25) |
| InChIKey | FGEDTCGPOZSWDY-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|