C22H29NO4 — CID 43916329
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(2,5-dimethylphenoxy)butanamide (PubChem CID 43916329) has the molecular formula C22H29NO4 and a molecular weight of 371.48 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(2,5-dimethylphenoxy)butanamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(2,5-dimethylphenoxy)butanamide |
|---|---|
| PubChem CID | 43916329 |
| Molecular Formula | C22H29NO4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(2,5-dimethylphenoxy)butanamide |
| SMILES | CCC(Oc1cc(C)ccc1C)C(=O)NCCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C22H29NO4/c1-6-18(27-20-13-15(2)7-8-16(20)3)22(24)23-12-11-17-9-10-19(25-4)21(14-17)26-5/h7-10,13-14,18H,6,11-12H2,1-5H3,(H,23,24) |
| InChIKey | NNLLGIPBKNXXGP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |