C19H30N2O3 — CID 43916472
2-(3,4-dimethylphenoxy)-N-(3-morpholin-4-ylpropyl)butanamide (PubChem CID 43916472) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is 2-(3,4-dimethylphenoxy)-N-(3-morpholin-4-ylpropyl)butanamide.
| Compound Name | 2-(3,4-dimethylphenoxy)-N-(3-morpholin-4-ylpropyl)butanamide |
|---|---|
| PubChem CID | 43916472 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | 2-(3,4-dimethylphenoxy)-N-(3-morpholin-4-ylpropyl)butanamide |
| SMILES | CCC(Oc1ccc(C)c(C)c1)C(=O)NCCCN1CCOCC1 |
| InChI | InChI=1S/C19H30N2O3/c1-4-18(24-17-7-6-15(2)16(3)14-17)19(22)20-8-5-9-21-10-12-23-13-11-21/h6-7,14,18H,4-5,8-13H2,1-3H3,(H,20,22) |
| InChIKey | TZVDFUNVLJQGFU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|