C25H33N3O2 — CID 43917296
1-benzyl-N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]piperidine-3-carboxamide (PubChem CID 43917296) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is 1-benzyl-N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]piperidine-3-carboxamide.
| Compound Name | 1-benzyl-N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43917296 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | 1-benzyl-N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]piperidine-3-carboxamide |
| SMILES | O=C(NCc1ccc(CN2CCOCC2)cc1)C1CCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C25H33N3O2/c29-25(24-7-4-12-28(20-24)19-22-5-2-1-3-6-22)26-17-21-8-10-23(11-9-21)18-27-13-15-30-16-14-27/h1-3,5-6,8-11,24H,4,7,12-20H2,(H,26,29) |
| InChIKey | LYWOSYNHXAOSCJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |