C17H25N3O3S — CID 43918535
4-[(4-ethylsulfonylpiperazin-1-yl)methyl]-N-prop-2-enylbenzamide (PubChem CID 43918535) has the molecular formula C17H25N3O3S and a molecular weight of 351.47 g/mol. Its IUPAC name is 4-[(4-ethylsulfonylpiperazin-1-yl)methyl]-N-prop-2-enylbenzamide.
| Compound Name | 4-[(4-ethylsulfonylpiperazin-1-yl)methyl]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 43918535 |
| Molecular Formula | C17H25N3O3S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 4-[(4-ethylsulfonylpiperazin-1-yl)methyl]-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1ccc(CN2CCN(S(=O)(=O)CC)CC2)cc1 |
| InChI | InChI=1S/C17H25N3O3S/c1-3-9-18-17(21)16-7-5-15(6-8-16)14-19-10-12-20(13-11-19)24(22,23)4-2/h3,5-8H,1,4,9-14H2,2H3,(H,18,21) |
| InChIKey | UENNZZYYPASIGS-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|