C21H23BrN2O3 — CID 43919896
methyl 2-[[1-[(4-bromophenyl)methyl]piperidine-4-carbonyl]amino]benzoate (PubChem CID 43919896) has the molecular formula C21H23BrN2O3 and a molecular weight of 431.33 g/mol. Its IUPAC name is methyl 2-[[1-[(4-bromophenyl)methyl]piperidine-4-carbonyl]amino]benzoate.
| Compound Name | methyl 2-[[1-[(4-bromophenyl)methyl]piperidine-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 43919896 |
| Molecular Formula | C21H23BrN2O3 |
| Molecular Weight | 431.33 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | methyl 2-[[1-[(4-bromophenyl)methyl]piperidine-4-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)C1CCN(Cc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C21H23BrN2O3/c1-27-21(26)18-4-2-3-5-19(18)23-20(25)16-10-12-24(13-11-16)14-15-6-8-17(22)9-7-15/h2-9,16H,10-14H2,1H3,(H,23,25) |
| InChIKey | QPYPBZHZYKWSLH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.33 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |