C19H19BrClFN2O — CID 43920134
N-(2-bromophenyl)-1-[(2-chloro-6-fluorophenyl)methyl]piperidine-3-carboxamide (PubChem CID 43920134) has the molecular formula C19H19BrClFN2O and a molecular weight of 425.73 g/mol. Its IUPAC name is N-(2-bromophenyl)-1-[(2-chloro-6-fluorophenyl)methyl]piperidine-3-carboxamide.
| Compound Name | N-(2-bromophenyl)-1-[(2-chloro-6-fluorophenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43920134 |
| Molecular Formula | C19H19BrClFN2O |
| Molecular Weight | 425.73 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | N-(2-bromophenyl)-1-[(2-chloro-6-fluorophenyl)methyl]piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1Br)C1CCCN(Cc2c(F)cccc2Cl)C1 |
| InChI | InChI=1S/C19H19BrClFN2O/c20-15-6-1-2-9-18(15)23-19(25)13-5-4-10-24(11-13)12-14-16(21)7-3-8-17(14)22/h1-3,6-9,13H,4-5,10-12H2,(H,23,25) |
| InChIKey | YHOUVVOLJMGRRK-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.73 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |