C26H27ClN2OS — CID 43922460
1-[(2-chlorophenyl)methyl]-N-[4-(phenylsulfanylmethyl)phenyl]piperidine-3-carboxamide (PubChem CID 43922460) has the molecular formula C26H27ClN2OS and a molecular weight of 451.04 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-N-[4-(phenylsulfanylmethyl)phenyl]piperidine-3-carboxamide.
| Compound Name | 1-[(2-chlorophenyl)methyl]-N-[4-(phenylsulfanylmethyl)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43922460 |
| Molecular Formula | C26H27ClN2OS |
| Molecular Weight | 451.04 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-N-[4-(phenylsulfanylmethyl)phenyl]piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(CSc2ccccc2)cc1)C1CCCN(Cc2ccccc2Cl)C1 |
| InChI | InChI=1S/C26H27ClN2OS/c27-25-11-5-4-7-21(25)17-29-16-6-8-22(18-29)26(30)28-23-14-12-20(13-15-23)19-31-24-9-2-1-3-10-24/h1-5,7,9-15,22H,6,8,16-19H2,(H,28,30) |
| InChIKey | ACHIEGATEHKDAX-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.04 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |