C20H23ClN2OS — CID 43924979
1-[(4-chlorophenyl)methyl]-N-(2-methylsulfanylphenyl)piperidine-3-carboxamide (PubChem CID 43924979) has the molecular formula C20H23ClN2OS and a molecular weight of 374.94 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-N-(2-methylsulfanylphenyl)piperidine-3-carboxamide.
| Compound Name | 1-[(4-chlorophenyl)methyl]-N-(2-methylsulfanylphenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43924979 |
| Molecular Formula | C20H23ClN2OS |
| Molecular Weight | 374.94 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-N-(2-methylsulfanylphenyl)piperidine-3-carboxamide |
| SMILES | CSc1ccccc1NC(=O)C1CCCN(Cc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C20H23ClN2OS/c1-25-19-7-3-2-6-18(19)22-20(24)16-5-4-12-23(14-16)13-15-8-10-17(21)11-9-15/h2-3,6-11,16H,4-5,12-14H2,1H3,(H,22,24) |
| InChIKey | VWQPIOBBMBKQDT-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.94 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |