C19H17Cl5N2O — CID 43926100
1-[(2,4-dichlorophenyl)methyl]-N-(2,4,5-trichlorophenyl)piperidine-3-carboxamide (PubChem CID 43926100) has the molecular formula C19H17Cl5N2O and a molecular weight of 466.62 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-N-(2,4,5-trichlorophenyl)piperidine-3-carboxamide.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-N-(2,4,5-trichlorophenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43926100 |
| Molecular Formula | C19H17Cl5N2O |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 463.98 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-N-(2,4,5-trichlorophenyl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1cc(Cl)c(Cl)cc1Cl)C1CCCN(Cc2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C19H17Cl5N2O/c20-13-4-3-11(14(21)6-13)9-26-5-1-2-12(10-26)19(27)25-18-8-16(23)15(22)7-17(18)24/h3-4,6-8,12H,1-2,5,9-10H2,(H,25,27) |
| InChIKey | RKRYRHUKMDANGD-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|