C27H32ClN5O2 — CID 43928072
1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[1-(4-pyrrolidin-1-ylphenyl)ethyl]piperidine-4-carboxamide (PubChem CID 43928072) has the molecular formula C27H32ClN5O2 and a molecular weight of 494.04 g/mol. Its IUPAC name is 1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[1-(4-pyrrolidin-1-ylphenyl)ethyl]piperidine-4-carboxamide.
| Compound Name | 1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[1-(4-pyrrolidin-1-ylphenyl)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 43928072 |
| Molecular Formula | C27H32ClN5O2 |
| Molecular Weight | 494.04 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | 1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[1-(4-pyrrolidin-1-ylphenyl)ethyl]piperidine-4-carboxamide |
| SMILES | CC(NC(=O)C1CCN(Cc2nc(-c3cccc(Cl)c3)no2)CC1)c1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C27H32ClN5O2/c1-19(20-7-9-24(10-8-20)33-13-2-3-14-33)29-27(34)21-11-15-32(16-12-21)18-25-30-26(31-35-25)22-5-4-6-23(28)17-22/h4-10,17,19,21H,2-3,11-16,18H2,1H3,(H,29,34) |
| InChIKey | RHJCMWAOSFIDBI-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.04 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|