C24H29N5O2S — CID 43928851
N-[3-(2,3-dihydroindol-1-yl)propyl]-1-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperidine-4-carboxamide (PubChem CID 43928851) has the molecular formula C24H29N5O2S and a molecular weight of 451.60 g/mol. Its IUPAC name is N-[3-(2,3-dihydroindol-1-yl)propyl]-1-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperidine-4-carboxamide.
| Compound Name | N-[3-(2,3-dihydroindol-1-yl)propyl]-1-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 43928851 |
| Molecular Formula | C24H29N5O2S |
| Molecular Weight | 451.60 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | N-[3-(2,3-dihydroindol-1-yl)propyl]-1-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperidine-4-carboxamide |
| SMILES | O=C(NCCCN1CCc2ccccc21)C1CCN(Cc2nc(-c3cccs3)no2)CC1 |
| InChI | InChI=1S/C24H29N5O2S/c30-24(25-11-4-12-29-15-10-18-5-1-2-6-20(18)29)19-8-13-28(14-9-19)17-22-26-23(27-31-22)21-7-3-16-32-21/h1-3,5-7,16,19H,4,8-15,17H2,(H,25,30) |
| InChIKey | ZDJYNBUOIDALIB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.60 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|