C23H25IN4O2 — CID 43929592
N-(4-iodo-2-methylphenyl)-1-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-3-carboxamide (PubChem CID 43929592) has the molecular formula C23H25IN4O2 and a molecular weight of 516.38 g/mol. Its IUPAC name is N-(4-iodo-2-methylphenyl)-1-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-3-carboxamide.
| Compound Name | N-(4-iodo-2-methylphenyl)-1-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43929592 |
| Molecular Formula | C23H25IN4O2 |
| Molecular Weight | 516.38 g/mol |
| Exact Mass | 516.10 |
| IUPAC Name | N-(4-iodo-2-methylphenyl)-1-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-3-carboxamide |
| SMILES | Cc1cc(I)ccc1NC(=O)C1CCCN(Cc2nc(-c3ccccc3C)no2)C1 |
| InChI | InChI=1S/C23H25IN4O2/c1-15-6-3-4-8-19(15)22-26-21(30-27-22)14-28-11-5-7-17(13-28)23(29)25-20-10-9-18(24)12-16(20)2/h3-4,6,8-10,12,17H,5,7,11,13-14H2,1-2H3,(H,25,29) |
| InChIKey | DMMDDBJMXJCRQP-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.38 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|