C29H37N5O2 — CID 43929809
1-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[1-(4-piperidin-1-ylphenyl)ethyl]piperidine-3-carboxamide (PubChem CID 43929809) has the molecular formula C29H37N5O2 and a molecular weight of 487.65 g/mol. Its IUPAC name is 1-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[1-(4-piperidin-1-ylphenyl)ethyl]piperidine-3-carboxamide.
| Compound Name | 1-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[1-(4-piperidin-1-ylphenyl)ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43929809 |
| Molecular Formula | C29H37N5O2 |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.29 |
| IUPAC Name | 1-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[1-(4-piperidin-1-ylphenyl)ethyl]piperidine-3-carboxamide |
| SMILES | Cc1ccccc1-c1noc(CN2CCCC(C(=O)NC(C)c3ccc(N4CCCCC4)cc3)C2)n1 |
| InChI | InChI=1S/C29H37N5O2/c1-21-9-4-5-11-26(21)28-31-27(36-32-28)20-33-16-8-10-24(19-33)29(35)30-22(2)23-12-14-25(15-13-23)34-17-6-3-7-18-34/h4-5,9,11-15,22,24H,3,6-8,10,16-20H2,1-2H3,(H,30,35) |
| InChIKey | BEFVYKXKHNCDJK-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|