C27H31FN4O3 — CID 43931878
1-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)piperidine-3-carboxamide (PubChem CID 43931878) has the molecular formula C27H31FN4O3 and a molecular weight of 478.57 g/mol. Its IUPAC name is 1-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)piperidine-3-carboxamide.
| Compound Name | 1-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43931878 |
| Molecular Formula | C27H31FN4O3 |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | 1-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)piperidine-3-carboxamide |
| SMILES | Cc1ccc2c(c1)C(NC(=O)C1CCCN(Cc3nc(-c4ccc(F)cc4)no3)C1)CC(C)(C)O2 |
| InChI | InChI=1S/C27H31FN4O3/c1-17-6-11-23-21(13-17)22(14-27(2,3)34-23)29-26(33)19-5-4-12-32(15-19)16-24-30-25(31-35-24)18-7-9-20(28)10-8-18/h6-11,13,19,22H,4-5,12,14-16H2,1-3H3,(H,29,33) |
| InChIKey | VWHRSESHEZBOOD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |