C25H27Cl2N5O4S — CID 43934711
1-[1-[[3-(2,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-3-carbonyl]-N,N-dimethyl-2,3-dihydroindole-5-sulfonamide (PubChem CID 43934711) has the molecular formula C25H27Cl2N5O4S and a molecular weight of 564.50 g/mol. Its IUPAC name is 1-[1-[[3-(2,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-3-carbonyl]-N,N-dimethyl-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-[1-[[3-(2,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-3-carbonyl]-N,N-dimethyl-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 43934711 |
| Molecular Formula | C25H27Cl2N5O4S |
| Molecular Weight | 564.50 g/mol |
| Exact Mass | 563.12 |
| IUPAC Name | 1-[1-[[3-(2,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-3-carbonyl]-N,N-dimethyl-2,3-dihydroindole-5-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc2c(c1)CCN2C(=O)C1CCCN(Cc2nc(-c3ccc(Cl)cc3Cl)no2)C1 |
| InChI | InChI=1S/C25H27Cl2N5O4S/c1-30(2)37(34,35)19-6-8-22-16(12-19)9-11-32(22)25(33)17-4-3-10-31(14-17)15-23-28-24(29-36-23)20-7-5-18(26)13-21(20)27/h5-8,12-13,17H,3-4,9-11,14-15H2,1-2H3 |
| InChIKey | DICPGUQHNGAGJM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 99.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |