C17H17N5O5 — CID 43935916
ethyl 4-[3-(4-methoxyphenyl)-7-oxotriazolo[4,5-d]pyrimidin-6-yl]-3-oxobutanoate (PubChem CID 43935916) has the molecular formula C17H17N5O5 and a molecular weight of 371.35 g/mol. Its IUPAC name is ethyl 4-[3-(4-methoxyphenyl)-7-oxotriazolo[4,5-d]pyrimidin-6-yl]-3-oxobutanoate.
| Compound Name | ethyl 4-[3-(4-methoxyphenyl)-7-oxotriazolo[4,5-d]pyrimidin-6-yl]-3-oxobutanoate |
|---|---|
| PubChem CID | 43935916 |
| Molecular Formula | C17H17N5O5 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | ethyl 4-[3-(4-methoxyphenyl)-7-oxotriazolo[4,5-d]pyrimidin-6-yl]-3-oxobutanoate |
| SMILES | CCOC(=O)CC(=O)Cn1cnc2c(nnn2-c2ccc(OC)cc2)c1=O |
| InChI | InChI=1S/C17H17N5O5/c1-3-27-14(24)8-12(23)9-21-10-18-16-15(17(21)25)19-20-22(16)11-4-6-13(26-2)7-5-11/h4-7,10H,3,8-9H2,1-2H3 |
| InChIKey | QIQITLKMRIQAPZ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 118.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|