C24H22N2O7S — CID 43947524
ethyl 3-[[4-[furan-2-ylmethyl(methyl)sulfamoyl]benzoyl]amino]-1-benzofuran-2-carboxylate (PubChem CID 43947524) has the molecular formula C24H22N2O7S and a molecular weight of 482.51 g/mol. Its IUPAC name is ethyl 3-[[4-[furan-2-ylmethyl(methyl)sulfamoyl]benzoyl]amino]-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 3-[[4-[furan-2-ylmethyl(methyl)sulfamoyl]benzoyl]amino]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 43947524 |
| Molecular Formula | C24H22N2O7S |
| Molecular Weight | 482.51 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | ethyl 3-[[4-[furan-2-ylmethyl(methyl)sulfamoyl]benzoyl]amino]-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc2ccccc2c1NC(=O)c1ccc(S(=O)(=O)N(C)Cc2ccco2)cc1 |
| InChI | InChI=1S/C24H22N2O7S/c1-3-31-24(28)22-21(19-8-4-5-9-20(19)33-22)25-23(27)16-10-12-18(13-11-16)34(29,30)26(2)15-17-7-6-14-32-17/h4-14H,3,15H2,1-2H3,(H,25,27) |
| InChIKey | ZWKMFMVDASAWJE-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 119.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |