About 3-[(4-bromophenyl)methoxy]-4-(4-methylpiperidin-1-yl)-1,2,5-thiadiazole
3-[(4-bromophenyl)methoxy]-4-(4-methylpiperidin-1-yl)-1,2,5-thiadiazole (PubChem CID 43949650) has the molecular formula C15H18BrN3OS
and a molecular weight of 368.30 g/mol. Its IUPAC name is 3-[(4-bromophenyl)methoxy]-4-(4-methylpiperidin-1-yl)-1,2,5-thiadiazole.
Molecular Properties
| Compound Name | 3-[(4-bromophenyl)methoxy]-4-(4-methylpiperidin-1-yl)-1,2,5-thiadiazole |
| PubChem CID | 43949650 |
| Molecular Formula | C15H18BrN3OS |
| Molecular Weight | 368.30 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | 3-[(4-bromophenyl)methoxy]-4-(4-methylpiperidin-1-yl)-1,2,5-thiadiazole |
| SMILES | CC1CCN(c2nsnc2OCc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C15H18BrN3OS/c1-11-6-8-19(9-7-11)14-15(18-21-17-14)20-10-12-2-4-13(16)5-3-12/h2-5,11H,6-10H2,1H3 |
| InChIKey | JUJAWMFSWIOHGO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.30 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(4-bromophenyl)methoxy]-4-(4-methylpiperidin-1-yl)-1,2,5-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-bromophenyl)methoxy]-4-(4-methylpiperidin-1-yl)-1,2,5-thiadiazole?
The IUPAC name of 3-[(4-bromophenyl)methoxy]-4-(4-methylpiperidin-1-yl)-1,2,5-thiadiazole (CID 43949650) is 3-[(4-bromophenyl)methoxy]-4-(4-methylpiperidin-1-yl)-1,2,5-thiadiazole.
What is the SMILES notation for 3-[(4-bromophenyl)methoxy]-4-(4-methylpiperidin-1-yl)-1,2,5-thiadiazole?
The canonical SMILES for 3-[(4-bromophenyl)methoxy]-4-(4-methylpiperidin-1-yl)-1,2,5-thiadiazole is CC1CCN(c2nsnc2OCc2ccc(Br)cc2)CC1.
What is the InChIKey of 3-[(4-bromophenyl)methoxy]-4-(4-methylpiperidin-1-yl)-1,2,5-thiadiazole?
The InChIKey is JUJAWMFSWIOHGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18BrN3OS/c1-11-6-8-19(9-7-11)14-15(18-21-17-14)20-10-12-2-4-13(16)5-3-12/h2-5,11H,6-10H2,1H3.
What are the key properties of 3-[(4-bromophenyl)methoxy]-4-(4-methylpiperidin-1-yl)-1,2,5-thiadiazole?
3-[(4-bromophenyl)methoxy]-4-(4-methylpiperidin-1-yl)-1,2,5-thiadiazole has a molecular weight of 368.30 g/mol, XLogP of 4.12, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-bromophenyl)methoxy]-4-(4-methylpiperidin-1-yl)-1,2,5-thiadiazole is sourced from PubChem (CID 43949650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).