C21H26N2O2S — CID 43951093
6-methyl-2-[[2-(2,4,6-trimethylphenyl)acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 43951093) has the molecular formula C21H26N2O2S and a molecular weight of 370.52 g/mol. Its IUPAC name is 6-methyl-2-[[2-(2,4,6-trimethylphenyl)acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 6-methyl-2-[[2-(2,4,6-trimethylphenyl)acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 43951093 |
| Molecular Formula | C21H26N2O2S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 6-methyl-2-[[2-(2,4,6-trimethylphenyl)acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | Cc1cc(C)c(CC(=O)Nc2sc3c(c2C(N)=O)CCC(C)C3)c(C)c1 |
| InChI | InChI=1S/C21H26N2O2S/c1-11-5-6-15-17(9-11)26-21(19(15)20(22)25)23-18(24)10-16-13(3)7-12(2)8-14(16)4/h7-8,11H,5-6,9-10H2,1-4H3,(H2,22,25)(H,23,24) |
| InChIKey | JVYGVRILCRQRRX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |