C20H20FN3O4S — CID 43953473
N-[(2,5-dimethoxy-2H-furan-5-yl)methyl]-6-(4-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide (PubChem CID 43953473) has the molecular formula C20H20FN3O4S and a molecular weight of 417.46 g/mol. Its IUPAC name is N-[(2,5-dimethoxy-2H-furan-5-yl)methyl]-6-(4-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide.
| Compound Name | N-[(2,5-dimethoxy-2H-furan-5-yl)methyl]-6-(4-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide |
|---|---|
| PubChem CID | 43953473 |
| Molecular Formula | C20H20FN3O4S |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | N-[(2,5-dimethoxy-2H-furan-5-yl)methyl]-6-(4-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide |
| SMILES | COC1C=CC(CNC(=O)c2sc3nc(-c4ccc(F)cc4)cn3c2C)(OC)O1 |
| InChI | InChI=1S/C20H20FN3O4S/c1-12-17(18(25)22-11-20(27-3)9-8-16(26-2)28-20)29-19-23-15(10-24(12)19)13-4-6-14(21)7-5-13/h4-10,16H,11H2,1-3H3,(H,22,25) |
| InChIKey | LIEWUIKUUBBKIQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_misc_A(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|