C25H23N3O6S — CID 43953675
2-[2-(3,4-dimethoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl]-N-(3-nitrophenyl)acetamide (PubChem CID 43953675) has the molecular formula C25H23N3O6S and a molecular weight of 493.54 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl]-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl]-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 43953675 |
| Molecular Formula | C25H23N3O6S |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl]-N-(3-nitrophenyl)acetamide |
| SMILES | COc1ccc(C2CC(=O)N(CC(=O)Nc3cccc([N+](=O)[O-])c3)c3ccccc3S2)cc1OC |
| InChI | InChI=1S/C25H23N3O6S/c1-33-20-11-10-16(12-21(20)34-2)23-14-25(30)27(19-8-3-4-9-22(19)35-23)15-24(29)26-17-6-5-7-18(13-17)28(31)32/h3-13,23H,14-15H2,1-2H3,(H,26,29) |
| InChIKey | NJARLPYKVROXGI-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|