C16H19N3O4 — CID 43954415
ethyl 3,5-dimethyl-4-(1,2-oxazol-3-ylcarbamoyl)-1-prop-2-enylpyrrole-2-carboxylate (PubChem CID 43954415) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is ethyl 3,5-dimethyl-4-(1,2-oxazol-3-ylcarbamoyl)-1-prop-2-enylpyrrole-2-carboxylate.
| Compound Name | ethyl 3,5-dimethyl-4-(1,2-oxazol-3-ylcarbamoyl)-1-prop-2-enylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 43954415 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | ethyl 3,5-dimethyl-4-(1,2-oxazol-3-ylcarbamoyl)-1-prop-2-enylpyrrole-2-carboxylate |
| SMILES | C=CCn1c(C)c(C(=O)Nc2ccon2)c(C)c1C(=O)OCC |
| InChI | InChI=1S/C16H19N3O4/c1-5-8-19-11(4)13(10(3)14(19)16(21)22-6-2)15(20)17-12-7-9-23-18-12/h5,7,9H,1,6,8H2,2-4H3,(H,17,18,20) |
| InChIKey | MQDBKUMIHQJPHR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|