About 4-tert-butyl-N-(3-chlorophenyl)-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)benzamide
4-tert-butyl-N-(3-chlorophenyl)-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)benzamide (PubChem CID 43954685) has the molecular formula C21H22ClNO3S
and a molecular weight of 403.93 g/mol. Its IUPAC name is 4-tert-butyl-N-(3-chlorophenyl)-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)benzamide.
Molecular Properties
| Compound Name | 4-tert-butyl-N-(3-chlorophenyl)-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)benzamide |
| PubChem CID | 43954685 |
| Molecular Formula | C21H22ClNO3S |
| Molecular Weight | 403.93 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 4-tert-butyl-N-(3-chlorophenyl)-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)N(c2cccc(Cl)c2)C2C=CS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C21H22ClNO3S/c1-21(2,3)16-9-7-15(8-10-16)20(24)23(18-6-4-5-17(22)13-18)19-11-12-27(25,26)14-19/h4-13,19H,14H2,1-3H3 |
| InChIKey | MUNKCNHYKRBZFL-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.93 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-tert-butyl-N-(3-chlorophenyl)-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-N-(3-chlorophenyl)-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)benzamide?
The IUPAC name of 4-tert-butyl-N-(3-chlorophenyl)-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)benzamide (CID 43954685) is 4-tert-butyl-N-(3-chlorophenyl)-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)benzamide.
What is the SMILES notation for 4-tert-butyl-N-(3-chlorophenyl)-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)benzamide?
The canonical SMILES for 4-tert-butyl-N-(3-chlorophenyl)-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)benzamide is CC(C)(C)c1ccc(C(=O)N(c2cccc(Cl)c2)C2C=CS(=O)(=O)C2)cc1.
What is the InChIKey of 4-tert-butyl-N-(3-chlorophenyl)-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)benzamide?
The InChIKey is MUNKCNHYKRBZFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22ClNO3S/c1-21(2,3)16-9-7-15(8-10-16)20(24)23(18-6-4-5-17(22)13-18)19-11-12-27(25,26)14-19/h4-13,19H,14H2,1-3H3.
What are the key properties of 4-tert-butyl-N-(3-chlorophenyl)-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)benzamide?
4-tert-butyl-N-(3-chlorophenyl)-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)benzamide has a molecular weight of 403.93 g/mol, XLogP of 4.59, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-N-(3-chlorophenyl)-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)benzamide is sourced from PubChem (CID 43954685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).