C20H24F3N3O — CID 43956057
N-[2-(dimethylamino)-2-[4-(dimethylamino)phenyl]ethyl]-4-(trifluoromethyl)benzamide (PubChem CID 43956057) has the molecular formula C20H24F3N3O and a molecular weight of 379.43 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-[4-(dimethylamino)phenyl]ethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-(dimethylamino)-2-[4-(dimethylamino)phenyl]ethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 43956057 |
| Molecular Formula | C20H24F3N3O |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | N-[2-(dimethylamino)-2-[4-(dimethylamino)phenyl]ethyl]-4-(trifluoromethyl)benzamide |
| SMILES | CN(C)c1ccc(C(CNC(=O)c2ccc(C(F)(F)F)cc2)N(C)C)cc1 |
| InChI | InChI=1S/C20H24F3N3O/c1-25(2)17-11-7-14(8-12-17)18(26(3)4)13-24-19(27)15-5-9-16(10-6-15)20(21,22)23/h5-12,18H,13H2,1-4H3,(H,24,27) |
| InChIKey | CVKKSXGDRZRFTQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|