C29H37FN4O2S — CID 43957189
N-[2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-2,4,5-trimethylbenzenesulfonamide (PubChem CID 43957189) has the molecular formula C29H37FN4O2S and a molecular weight of 524.71 g/mol. Its IUPAC name is N-[2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-2,4,5-trimethylbenzenesulfonamide.
| Compound Name | N-[2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-2,4,5-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 43957189 |
| Molecular Formula | C29H37FN4O2S |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | N-[2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-2,4,5-trimethylbenzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)NCC(c2ccc(N(C)C)cc2)N2CCN(c3ccc(F)cc3)CC2)cc1C |
| InChI | InChI=1S/C29H37FN4O2S/c1-21-18-23(3)29(19-22(21)2)37(35,36)31-20-28(24-6-10-26(11-7-24)32(4)5)34-16-14-33(15-17-34)27-12-8-25(30)9-13-27/h6-13,18-19,28,31H,14-17,20H2,1-5H3 |
| InChIKey | DHFUGZHKRLWVCK-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|