About 6-fluoro-3-(2-methyl-2,3-dihydroindol-1-yl)thiochromen-4-one
6-fluoro-3-(2-methyl-2,3-dihydroindol-1-yl)thiochromen-4-one (PubChem CID 43957296) has the molecular formula C18H14FNOS
and a molecular weight of 311.38 g/mol. Its IUPAC name is 6-fluoro-3-(2-methyl-2,3-dihydroindol-1-yl)thiochromen-4-one.
Molecular Properties
| Compound Name | 6-fluoro-3-(2-methyl-2,3-dihydroindol-1-yl)thiochromen-4-one |
| PubChem CID | 43957296 |
| Molecular Formula | C18H14FNOS |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 6-fluoro-3-(2-methyl-2,3-dihydroindol-1-yl)thiochromen-4-one |
| SMILES | CC1Cc2ccccc2N1c1csc2ccc(F)cc2c1=O |
| InChI | InChI=1S/C18H14FNOS/c1-11-8-12-4-2-3-5-15(12)20(11)16-10-22-17-7-6-13(19)9-14(17)18(16)21/h2-7,9-11H,8H2,1H3 |
| InChIKey | NKVJAOHBOHMYLJ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-fluoro-3-(2-methyl-2,3-dihydroindol-1-yl)thiochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-3-(2-methyl-2,3-dihydroindol-1-yl)thiochromen-4-one?
The IUPAC name of 6-fluoro-3-(2-methyl-2,3-dihydroindol-1-yl)thiochromen-4-one (CID 43957296) is 6-fluoro-3-(2-methyl-2,3-dihydroindol-1-yl)thiochromen-4-one.
What is the SMILES notation for 6-fluoro-3-(2-methyl-2,3-dihydroindol-1-yl)thiochromen-4-one?
The canonical SMILES for 6-fluoro-3-(2-methyl-2,3-dihydroindol-1-yl)thiochromen-4-one is CC1Cc2ccccc2N1c1csc2ccc(F)cc2c1=O.
What is the InChIKey of 6-fluoro-3-(2-methyl-2,3-dihydroindol-1-yl)thiochromen-4-one?
The InChIKey is NKVJAOHBOHMYLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14FNOS/c1-11-8-12-4-2-3-5-15(12)20(11)16-10-22-17-7-6-13(19)9-14(17)18(16)21/h2-7,9-11H,8H2,1H3.
What are the key properties of 6-fluoro-3-(2-methyl-2,3-dihydroindol-1-yl)thiochromen-4-one?
6-fluoro-3-(2-methyl-2,3-dihydroindol-1-yl)thiochromen-4-one has a molecular weight of 311.38 g/mol, XLogP of 4.48, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-3-(2-methyl-2,3-dihydroindol-1-yl)thiochromen-4-one is sourced from PubChem (CID 43957296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).