C20H25FN6O3 — CID 43957658
N-[2-[6-(2,2-diethoxyethylamino)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]ethyl]-3-fluorobenzamide (PubChem CID 43957658) has the molecular formula C20H25FN6O3 and a molecular weight of 416.46 g/mol. Its IUPAC name is N-[2-[6-(2,2-diethoxyethylamino)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]ethyl]-3-fluorobenzamide.
| Compound Name | N-[2-[6-(2,2-diethoxyethylamino)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]ethyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 43957658 |
| Molecular Formula | C20H25FN6O3 |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | N-[2-[6-(2,2-diethoxyethylamino)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]ethyl]-3-fluorobenzamide |
| SMILES | CCOC(CNc1ccc2nnc(CCNC(=O)c3cccc(F)c3)n2n1)OCC |
| InChI | InChI=1S/C20H25FN6O3/c1-3-29-19(30-4-2)13-23-16-8-9-17-24-25-18(27(17)26-16)10-11-22-20(28)14-6-5-7-15(21)12-14/h5-9,12,19H,3-4,10-11,13H2,1-2H3,(H,22,28)(H,23,26) |
| InChIKey | MGXGDXBCLZQNJC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|