C14H25N7O2S — CID 43958023
N-[2-[6-[3-(dimethylamino)propylamino]-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]ethyl]ethanesulfonamide (PubChem CID 43958023) has the molecular formula C14H25N7O2S and a molecular weight of 355.47 g/mol. Its IUPAC name is N-[2-[6-[3-(dimethylamino)propylamino]-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]ethyl]ethanesulfonamide.
| Compound Name | N-[2-[6-[3-(dimethylamino)propylamino]-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]ethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 43958023 |
| Molecular Formula | C14H25N7O2S |
| Molecular Weight | 355.47 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | N-[2-[6-[3-(dimethylamino)propylamino]-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]ethyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCCc1nnc2ccc(NCCCN(C)C)nn12 |
| InChI | InChI=1S/C14H25N7O2S/c1-4-24(22,23)16-10-8-14-18-17-13-7-6-12(19-21(13)14)15-9-5-11-20(2)3/h6-7,16H,4-5,8-11H2,1-3H3,(H,15,19) |
| InChIKey | PVQDENJHAMWAJG-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 104.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.47 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|