C27H34N4O4S2 — CID 43959700
4-[bis(prop-2-enyl)sulfamoyl]-N-[2-(diethylamino)ethyl]-N-(4-methoxy-1,3-benzothiazol-2-yl)benzamide (PubChem CID 43959700) has the molecular formula C27H34N4O4S2 and a molecular weight of 542.73 g/mol. Its IUPAC name is 4-[bis(prop-2-enyl)sulfamoyl]-N-[2-(diethylamino)ethyl]-N-(4-methoxy-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 4-[bis(prop-2-enyl)sulfamoyl]-N-[2-(diethylamino)ethyl]-N-(4-methoxy-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 43959700 |
| Molecular Formula | C27H34N4O4S2 |
| Molecular Weight | 542.73 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | 4-[bis(prop-2-enyl)sulfamoyl]-N-[2-(diethylamino)ethyl]-N-(4-methoxy-1,3-benzothiazol-2-yl)benzamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccc(C(=O)N(CCN(CC)CC)c2nc3c(OC)cccc3s2)cc1 |
| InChI | InChI=1S/C27H34N4O4S2/c1-6-17-30(18-7-2)37(33,34)22-15-13-21(14-16-22)26(32)31(20-19-29(8-3)9-4)27-28-25-23(35-5)11-10-12-24(25)36-27/h6-7,10-16H,1-2,8-9,17-20H2,3-5H3 |
| InChIKey | UABGRGHZKXFMCP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 83.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.73 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|