C25H30ClN3O3S2 — CID 43963021
N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-4-(4-methylphenyl)sulfanyl-N-(2-morpholin-4-ylethyl)butanamide (PubChem CID 43963021) has the molecular formula C25H30ClN3O3S2 and a molecular weight of 520.12 g/mol. Its IUPAC name is N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-4-(4-methylphenyl)sulfanyl-N-(2-morpholin-4-ylethyl)butanamide.
| Compound Name | N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-4-(4-methylphenyl)sulfanyl-N-(2-morpholin-4-ylethyl)butanamide |
|---|---|
| PubChem CID | 43963021 |
| Molecular Formula | C25H30ClN3O3S2 |
| Molecular Weight | 520.12 g/mol |
| Exact Mass | 519.14 |
| IUPAC Name | N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-4-(4-methylphenyl)sulfanyl-N-(2-morpholin-4-ylethyl)butanamide |
| SMILES | COc1ccc(Cl)c2sc(N(CCN3CCOCC3)C(=O)CCCSc3ccc(C)cc3)nc12 |
| InChI | InChI=1S/C25H30ClN3O3S2/c1-18-5-7-19(8-6-18)33-17-3-4-22(30)29(12-11-28-13-15-32-16-14-28)25-27-23-21(31-2)10-9-20(26)24(23)34-25/h5-10H,3-4,11-17H2,1-2H3 |
| InChIKey | XLXKISBPSKSJSC-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.12 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|