C26H23ClN4O3S2 — CID 43966129
4-[bis(prop-2-enyl)sulfamoyl]-N-(4-chloro-1,3-benzothiazol-2-yl)-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 43966129) has the molecular formula C26H23ClN4O3S2 and a molecular weight of 539.08 g/mol. Its IUPAC name is 4-[bis(prop-2-enyl)sulfamoyl]-N-(4-chloro-1,3-benzothiazol-2-yl)-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 4-[bis(prop-2-enyl)sulfamoyl]-N-(4-chloro-1,3-benzothiazol-2-yl)-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 43966129 |
| Molecular Formula | C26H23ClN4O3S2 |
| Molecular Weight | 539.08 g/mol |
| Exact Mass | 538.09 |
| IUPAC Name | 4-[bis(prop-2-enyl)sulfamoyl]-N-(4-chloro-1,3-benzothiazol-2-yl)-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccc(C(=O)N(Cc2cccnc2)c2nc3c(Cl)cccc3s2)cc1 |
| InChI | InChI=1S/C26H23ClN4O3S2/c1-3-15-30(16-4-2)36(33,34)21-12-10-20(11-13-21)25(32)31(18-19-7-6-14-28-17-19)26-29-24-22(27)8-5-9-23(24)35-26/h3-14,17H,1-2,15-16,18H2 |
| InChIKey | ZLPCYWUBXPOBCM-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.08 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|