C16H23N3O4 — CID 43969973
1-[1-(4-ethoxyphenyl)-5-oxopyrrolidin-3-yl]-3-(2-methoxyethyl)urea (PubChem CID 43969973) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is 1-[1-(4-ethoxyphenyl)-5-oxopyrrolidin-3-yl]-3-(2-methoxyethyl)urea.
| Compound Name | 1-[1-(4-ethoxyphenyl)-5-oxopyrrolidin-3-yl]-3-(2-methoxyethyl)urea |
|---|---|
| PubChem CID | 43969973 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 1-[1-(4-ethoxyphenyl)-5-oxopyrrolidin-3-yl]-3-(2-methoxyethyl)urea |
| SMILES | CCOc1ccc(N2CC(NC(=O)NCCOC)CC2=O)cc1 |
| InChI | InChI=1S/C16H23N3O4/c1-3-23-14-6-4-13(5-7-14)19-11-12(10-15(19)20)18-16(21)17-8-9-22-2/h4-7,12H,3,8-11H2,1-2H3,(H2,17,18,21) |
| InChIKey | LXUQHQKGDAUODN-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|