C18H22FN3O4 — CID 43970125
methyl 1-[[1-(3-fluorophenyl)-5-oxopyrrolidin-3-yl]carbamoyl]piperidine-4-carboxylate (PubChem CID 43970125) has the molecular formula C18H22FN3O4 and a molecular weight of 363.39 g/mol. Its IUPAC name is methyl 1-[[1-(3-fluorophenyl)-5-oxopyrrolidin-3-yl]carbamoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[[1-(3-fluorophenyl)-5-oxopyrrolidin-3-yl]carbamoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 43970125 |
| Molecular Formula | C18H22FN3O4 |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | methyl 1-[[1-(3-fluorophenyl)-5-oxopyrrolidin-3-yl]carbamoyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)NC2CC(=O)N(c3cccc(F)c3)C2)CC1 |
| InChI | InChI=1S/C18H22FN3O4/c1-26-17(24)12-5-7-21(8-6-12)18(25)20-14-10-16(23)22(11-14)15-4-2-3-13(19)9-15/h2-4,9,12,14H,5-8,10-11H2,1H3,(H,20,25) |
| InChIKey | DIBMHGUFQJVJLI-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |