C17H14F3N3O2 — CID 43970198
1-(2,4-difluorophenyl)-3-[1-(3-fluorophenyl)-5-oxopyrrolidin-3-yl]urea (PubChem CID 43970198) has the molecular formula C17H14F3N3O2 and a molecular weight of 349.31 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[1-(3-fluorophenyl)-5-oxopyrrolidin-3-yl]urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[1-(3-fluorophenyl)-5-oxopyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 43970198 |
| Molecular Formula | C17H14F3N3O2 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[1-(3-fluorophenyl)-5-oxopyrrolidin-3-yl]urea |
| SMILES | O=C(Nc1ccc(F)cc1F)NC1CC(=O)N(c2cccc(F)c2)C1 |
| InChI | InChI=1S/C17H14F3N3O2/c18-10-2-1-3-13(6-10)23-9-12(8-16(23)24)21-17(25)22-15-5-4-11(19)7-14(15)20/h1-7,12H,8-9H2,(H2,21,22,25) |
| InChIKey | MDVHGQDGOYFQQP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |